C27H40N4O3 — CID 42163475
(5R)-5-[1-(3-cyclopentylpropanoyl)piperidin-4-yl]-5-(3-methylbutyl)-3-(pyridin-2-ylmethyl)imidazolidine-2,4-dione (PubChem CID 42163475) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (5R)-5-[1-(3-cyclopentylpropanoyl)piperidin-4-yl]-5-(3-methylbutyl)-3-(pyridin-2-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-(3-cyclopentylpropanoyl)piperidin-4-yl]-5-(3-methylbutyl)-3-(pyridin-2-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42163475 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (5R)-5-[1-(3-cyclopentylpropanoyl)piperidin-4-yl]-5-(3-methylbutyl)-3-(pyridin-2-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)CC[C@]1(C2CCN(C(=O)CCC3CCCC3)CC2)NC(=O)N(Cc2ccccn2)C1=O |
| InChI | InChI=1S/C27H40N4O3/c1-20(2)12-15-27(25(33)31(26(34)29-27)19-23-9-5-6-16-28-23)22-13-17-30(18-14-22)24(32)11-10-21-7-3-4-8-21/h5-6,9,16,20-22H,3-4,7-8,10-15,17-19H2,1-2H3,(H,29,34)/t27-/m1/s1 |
| InChIKey | DQCSZWQFWNMYSH-HHHXNRCGSA-N |
| XLogP | 4.52 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|