C29H34FN3O3 — CID 26274397
(5R)-3-but-2-ynyl-5-[(3-fluorophenyl)methyl]-5-[1-[(4-methoxy-2,3-dimethylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 26274397) has the molecular formula C29H34FN3O3 and a molecular weight of 491.61 g/mol. Its IUPAC name is (5R)-3-but-2-ynyl-5-[(3-fluorophenyl)methyl]-5-[1-[(4-methoxy-2,3-dimethylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-but-2-ynyl-5-[(3-fluorophenyl)methyl]-5-[1-[(4-methoxy-2,3-dimethylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26274397 |
| Molecular Formula | C29H34FN3O3 |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | (5R)-3-but-2-ynyl-5-[(3-fluorophenyl)methyl]-5-[1-[(4-methoxy-2,3-dimethylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC#CCN1C(=O)N[C@](Cc2cccc(F)c2)(C2CCN(Cc3ccc(OC)c(C)c3C)CC2)C1=O |
| InChI | InChI=1S/C29H34FN3O3/c1-5-6-14-33-27(34)29(31-28(33)35,18-22-8-7-9-25(30)17-22)24-12-15-32(16-13-24)19-23-10-11-26(36-4)21(3)20(23)2/h7-11,17,24H,12-16,18-19H2,1-4H3,(H,31,35)/t29-/m1/s1 |
| InChIKey | QJQHREKOEHFXCK-GDLZYMKVSA-N |
| XLogP | 4.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|