C19H27N3O3 — CID 42367407
(5S)-5-[1-[(4-methoxy-2,3-dimethylphenyl)methyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 42367407) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (5S)-5-[1-[(4-methoxy-2,3-dimethylphenyl)methyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-[(4-methoxy-2,3-dimethylphenyl)methyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42367407 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (5S)-5-[1-[(4-methoxy-2,3-dimethylphenyl)methyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2CCC([C@]3(C)NC(=O)NC3=O)CC2)c(C)c1C |
| InChI | InChI=1S/C19H27N3O3/c1-12-13(2)16(25-4)6-5-14(12)11-22-9-7-15(8-10-22)19(3)17(23)20-18(24)21-19/h5-6,15H,7-11H2,1-4H3,(H2,20,21,23,24)/t19-/m0/s1 |
| InChIKey | CPIWNEAMKQRGLY-IBGZPJMESA-N |
| XLogP | 2.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|