C15H27N3O2S — CID 124843308
(5R)-5-[1-(2-tert-butylsulfanylethyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 124843308) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is (5R)-5-[1-(2-tert-butylsulfanylethyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-(2-tert-butylsulfanylethyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124843308 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (5R)-5-[1-(2-tert-butylsulfanylethyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)SCCN1CCC([C@@]2(C)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C15H27N3O2S/c1-14(2,3)21-10-9-18-7-5-11(6-8-18)15(4)12(19)16-13(20)17-15/h11H,5-10H2,1-4H3,(H2,16,17,19,20)/t15-/m1/s1 |
| InChIKey | DMKQKFAHGKLJAS-OAHLLOKOSA-N |
| XLogP | 1.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|