C17H25N5O2 — CID 56713229
5-methyl-5-[1-[(2-propan-2-ylpyrimidin-4-yl)methyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 56713229) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-methyl-5-[1-[(2-propan-2-ylpyrimidin-4-yl)methyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[1-[(2-propan-2-ylpyrimidin-4-yl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56713229 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 5-methyl-5-[1-[(2-propan-2-ylpyrimidin-4-yl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC(C)c1nccc(CN2CCC(C3(C)NC(=O)NC3=O)CC2)n1 |
| InChI | InChI=1S/C17H25N5O2/c1-11(2)14-18-7-4-13(19-14)10-22-8-5-12(6-9-22)17(3)15(23)20-16(24)21-17/h4,7,11-12H,5-6,8-10H2,1-3H3,(H2,20,21,23,24) |
| InChIKey | VUKPINAHNTXHKE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|