C16H23N3O5 — CID 138033204
2,2-dimethyl-1-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)piperidine-1-carbonyl]cyclopropane-1-carboxylic acid (PubChem CID 138033204) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)piperidine-1-carbonyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-1-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)piperidine-1-carbonyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 138033204 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2,2-dimethyl-1-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)piperidine-1-carbonyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C2CCN(C(=O)C3(C(=O)O)CC3(C)C)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C16H23N3O5/c1-14(2)8-16(14,12(22)23)11(21)19-6-4-9(5-7-19)15(3)10(20)17-13(24)18-15/h9H,4-8H2,1-3H3,(H,22,23)(H2,17,18,20,24) |
| InChIKey | GSRBBPMPEHIOHX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|