C25H27N3O6 — CID 45249473
5-[1-[4-(2,5-dimethoxybenzoyl)benzoyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 45249473) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 5-[1-[4-(2,5-dimethoxybenzoyl)benzoyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[4-(2,5-dimethoxybenzoyl)benzoyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45249473 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 5-[1-[4-(2,5-dimethoxybenzoyl)benzoyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(OC)c(C(=O)c2ccc(C(=O)N3CCC(C4(C)NC(=O)NC4=O)CC3)cc2)c1 |
| InChI | InChI=1S/C25H27N3O6/c1-25(23(31)26-24(32)27-25)17-10-12-28(13-11-17)22(30)16-6-4-15(5-7-16)21(29)19-14-18(33-2)8-9-20(19)34-3/h4-9,14,17H,10-13H2,1-3H3,(H2,26,27,31,32) |
| InChIKey | KVWQQIAAXHHHMS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|