C16H20N4O6S — CID 24659198
5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl)-2-methoxy-N-methylbenzenesulfonamide (PubChem CID 24659198) has the molecular formula C16H20N4O6S and a molecular weight of 396.43 g/mol. Its IUPAC name is 5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl)-2-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl)-2-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24659198 |
| Molecular Formula | C16H20N4O6S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbonyl)-2-methoxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N2CCC3(CC2)NC(=O)NC3=O)ccc1OC |
| InChI | InChI=1S/C16H20N4O6S/c1-17-27(24,25)12-9-10(3-4-11(12)26-2)13(21)20-7-5-16(6-8-20)14(22)18-15(23)19-16/h3-4,9,17H,5-8H2,1-2H3,(H2,18,19,22,23) |
| InChIKey | DBMRGIOGIRMRAQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|