C19H30N4O3 — CID 120991384
5-[1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 120991384) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-[1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120991384 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 5-[1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(C2CCN(C(=O)C3CC4CCCC(C3)C4N)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H30N4O3/c1-19(17(25)21-18(26)22-19)14-5-7-23(8-6-14)16(24)13-9-11-3-2-4-12(10-13)15(11)20/h11-15H,2-10,20H2,1H3,(H2,21,22,25,26) |
| InChIKey | CXMFXPANXXBXIP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|