C28H32FN3O4 — CID 45211435
5-[1-(3,5-dimethylbenzoyl)piperidin-4-yl]-5-[(4-fluorophenyl)methyl]-3-(oxolan-3-yl)imidazolidine-2,4-dione (PubChem CID 45211435) has the molecular formula C28H32FN3O4 and a molecular weight of 493.58 g/mol. Its IUPAC name is 5-[1-(3,5-dimethylbenzoyl)piperidin-4-yl]-5-[(4-fluorophenyl)methyl]-3-(oxolan-3-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-(3,5-dimethylbenzoyl)piperidin-4-yl]-5-[(4-fluorophenyl)methyl]-3-(oxolan-3-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45211435 |
| Molecular Formula | C28H32FN3O4 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 5-[1-(3,5-dimethylbenzoyl)piperidin-4-yl]-5-[(4-fluorophenyl)methyl]-3-(oxolan-3-yl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(C)cc(C(=O)N2CCC(C3(Cc4ccc(F)cc4)NC(=O)N(C4CCOC4)C3=O)CC2)c1 |
| InChI | InChI=1S/C28H32FN3O4/c1-18-13-19(2)15-21(14-18)25(33)31-10-7-22(8-11-31)28(16-20-3-5-23(29)6-4-20)26(34)32(27(35)30-28)24-9-12-36-17-24/h3-6,13-15,22,24H,7-12,16-17H2,1-2H3,(H,30,35) |
| InChIKey | KKEMUSQRXVJNMU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|