C19H26FN3O2 — CID 95219274
(5R)-3-[(2-fluoro-5-methylphenyl)methyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione (PubChem CID 95219274) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is (5R)-3-[(2-fluoro-5-methylphenyl)methyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2-fluoro-5-methylphenyl)methyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95219274 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (5R)-3-[(2-fluoro-5-methylphenyl)methyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@]1(C2CCNCC2)NC(=O)N(Cc2cc(C)ccc2F)C1=O |
| InChI | InChI=1S/C19H26FN3O2/c1-3-8-19(15-6-9-21-10-7-15)17(24)23(18(25)22-19)12-14-11-13(2)4-5-16(14)20/h4-5,11,15,21H,3,6-10,12H2,1-2H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | WWOBVIPRXHRHBH-LJQANCHMSA-N |
| XLogP | 2.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|