C23H25ClFN3O4 — CID 45168671
5-[1-(5-chloro-2-fluorobenzoyl)piperidin-4-yl]-3-(furan-2-ylmethyl)-5-propylimidazolidine-2,4-dione (PubChem CID 45168671) has the molecular formula C23H25ClFN3O4 and a molecular weight of 461.92 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-fluorobenzoyl)piperidin-4-yl]-3-(furan-2-ylmethyl)-5-propylimidazolidine-2,4-dione.
| Compound Name | 5-[1-(5-chloro-2-fluorobenzoyl)piperidin-4-yl]-3-(furan-2-ylmethyl)-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45168671 |
| Molecular Formula | C23H25ClFN3O4 |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 5-[1-(5-chloro-2-fluorobenzoyl)piperidin-4-yl]-3-(furan-2-ylmethyl)-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1(C2CCN(C(=O)c3cc(Cl)ccc3F)CC2)NC(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C23H25ClFN3O4/c1-2-9-23(21(30)28(22(31)26-23)14-17-4-3-12-32-17)15-7-10-27(11-8-15)20(29)18-13-16(24)5-6-19(18)25/h3-6,12-13,15H,2,7-11,14H2,1H3,(H,26,31) |
| InChIKey | DCAQRSJJIBNDCP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|