C24H26FN3O3 — CID 42322122
(5S)-5-[(2-fluorophenyl)methyl]-5-[1-[(2R)-2-phenylpropanoyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42322122) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[(2R)-2-phenylpropanoyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[(2R)-2-phenylpropanoyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42322122 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (5S)-5-[(2-fluorophenyl)methyl]-5-[1-[(2R)-2-phenylpropanoyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | C[C@@H](C(=O)N1CCC([C@]2(Cc3ccccc3F)NC(=O)NC2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H26FN3O3/c1-16(17-7-3-2-4-8-17)21(29)28-13-11-19(12-14-28)24(22(30)26-23(31)27-24)15-18-9-5-6-10-20(18)25/h2-10,16,19H,11-15H2,1H3,(H2,26,27,30,31)/t16-,24+/m1/s1 |
| InChIKey | VGZVFRHOKBIADE-GYCJOSAFSA-N |
| XLogP | 2.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|