C26H30ClN3O3 — CID 42369335
(5R)-5-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-5-[(2-chlorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 42369335) has the molecular formula C26H30ClN3O3 and a molecular weight of 468.00 g/mol. Its IUPAC name is (5R)-5-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-5-[(2-chlorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-5-[(2-chlorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42369335 |
| Molecular Formula | C26H30ClN3O3 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (5R)-5-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-5-[(2-chlorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC([C@@]3(Cc4ccccc4Cl)NC(=O)NC3=O)CC2)cc1 |
| InChI | InChI=1S/C26H30ClN3O3/c1-25(2,3)19-10-8-17(9-11-19)22(31)30-14-12-20(13-15-30)26(23(32)28-24(33)29-26)16-18-6-4-5-7-21(18)27/h4-11,20H,12-16H2,1-3H3,(H2,28,29,32,33)/t26-/m1/s1 |
| InChIKey | XTYSBWULGMAZAQ-AREMUKBSSA-N |
| XLogP | 4.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|