C19H26FN3O2S — CID 126462350
5-[(2-fluorophenyl)methyl]-5-[1-(3-methylsulfanylpropyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 126462350) has the molecular formula C19H26FN3O2S and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-5-[1-(3-methylsulfanylpropyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(2-fluorophenyl)methyl]-5-[1-(3-methylsulfanylpropyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126462350 |
| Molecular Formula | C19H26FN3O2S |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-5-[1-(3-methylsulfanylpropyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CSCCCN1CCC(C2(Cc3ccccc3F)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C19H26FN3O2S/c1-26-12-4-9-23-10-7-15(8-11-23)19(17(24)21-18(25)22-19)13-14-5-2-3-6-16(14)20/h2-3,5-6,15H,4,7-13H2,1H3,(H2,21,22,24,25) |
| InChIKey | NHIWHUDVMWNWDY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|