C16H21N5O4 — CID 56721489
5-ethyl-5-[1-(2-methoxypyrimidine-5-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 56721489) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 5-ethyl-5-[1-(2-methoxypyrimidine-5-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-5-[1-(2-methoxypyrimidine-5-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56721489 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 5-ethyl-5-[1-(2-methoxypyrimidine-5-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CCC1(C2CCN(C(=O)c3cnc(OC)nc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C16H21N5O4/c1-3-16(13(23)19-14(24)20-16)11-4-6-21(7-5-11)12(22)10-8-17-15(25-2)18-9-10/h8-9,11H,3-7H2,1-2H3,(H2,19,20,23,24) |
| InChIKey | SRUCHXPQRVXZCS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|