C18H27N5O2 — CID 95206096
(5R)-5-ethyl-5-[1-(2-methyl-6-propylpyrimidin-4-yl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 95206096) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (5R)-5-ethyl-5-[1-(2-methyl-6-propylpyrimidin-4-yl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-[1-(2-methyl-6-propylpyrimidin-4-yl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95206096 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (5R)-5-ethyl-5-[1-(2-methyl-6-propylpyrimidin-4-yl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CCCc1cc(N2CCC([C@@]3(CC)NC(=O)NC3=O)CC2)nc(C)n1 |
| InChI | InChI=1S/C18H27N5O2/c1-4-6-14-11-15(20-12(3)19-14)23-9-7-13(8-10-23)18(5-2)16(24)21-17(25)22-18/h11,13H,4-10H2,1-3H3,(H2,21,22,24,25)/t18-/m1/s1 |
| InChIKey | WAVNHCZMHHBVDP-GOSISDBHSA-N |
| XLogP | 1.94 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|