C17H25N5O3 — CID 95198121
(5R)-5-ethyl-5-[1-[2-(2-ethylimidazol-1-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 95198121) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is (5R)-5-ethyl-5-[1-[2-(2-ethylimidazol-1-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-[1-[2-(2-ethylimidazol-1-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95198121 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (5R)-5-ethyl-5-[1-[2-(2-ethylimidazol-1-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CCc1nccn1CC(=O)N1CCC([C@@]2(CC)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C17H25N5O3/c1-3-13-18-7-10-22(13)11-14(23)21-8-5-12(6-9-21)17(4-2)15(24)19-16(25)20-17/h7,10,12H,3-6,8-9,11H2,1-2H3,(H2,19,20,24,25)/t17-/m1/s1 |
| InChIKey | HFLWFAWNNHAPCX-QGZVFWFLSA-N |
| XLogP | 0.67 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|