C21H24FN5O2 — CID 95215117
(5S)-5-[1-(2,5-dimethylpyrimidin-4-yl)piperidin-4-yl]-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 95215117) has the molecular formula C21H24FN5O2 and a molecular weight of 397.45 g/mol. Its IUPAC name is (5S)-5-[1-(2,5-dimethylpyrimidin-4-yl)piperidin-4-yl]-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-(2,5-dimethylpyrimidin-4-yl)piperidin-4-yl]-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95215117 |
| Molecular Formula | C21H24FN5O2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (5S)-5-[1-(2,5-dimethylpyrimidin-4-yl)piperidin-4-yl]-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ncc(C)c(N2CCC([C@]3(Cc4ccc(F)cc4)NC(=O)NC3=O)CC2)n1 |
| InChI | InChI=1S/C21H24FN5O2/c1-13-12-23-14(2)24-18(13)27-9-7-16(8-10-27)21(19(28)25-20(29)26-21)11-15-3-5-17(22)6-4-15/h3-6,12,16H,7-11H2,1-2H3,(H2,25,26,28,29)/t21-/m0/s1 |
| InChIKey | KTWXXNBBAVLYFN-NRFANRHFSA-N |
| XLogP | 2.27 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|