C15H27N3O — CID 91001277
1-(2,5-dimethylpyrimidin-4-yl)piperidin-4-one;ethane (PubChem CID 91001277) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrimidin-4-yl)piperidin-4-one;ethane.
| Compound Name | 1-(2,5-dimethylpyrimidin-4-yl)piperidin-4-one;ethane |
|---|---|
| PubChem CID | 91001277 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 1-(2,5-dimethylpyrimidin-4-yl)piperidin-4-one;ethane |
| SMILES | CC.CC.Cc1ncc(C)c(N2CCC(=O)CC2)n1 |
| InChI | InChI=1S/C11H15N3O.2C2H6/c1-8-7-12-9(2)13-11(8)14-5-3-10(15)4-6-14;2*1-2/h7H,3-6H2,1-2H3;2*1-2H3 |
| InChIKey | JJNQRMQTZVVJLB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |