C21H27FN4O — CID 178156897
ethane;1-[3-fluoro-5-[4-methyl-3-[(3Z)-penta-1,3-dien-2-yl]pyrazol-1-yl]-2-pyridinyl]piperidin-4-one (PubChem CID 178156897) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is ethane;1-[3-fluoro-5-[4-methyl-3-[(3Z)-penta-1,3-dien-2-yl]pyrazol-1-yl]-2-pyridinyl]piperidin-4-one.
| Compound Name | ethane;1-[3-fluoro-5-[4-methyl-3-[(3Z)-penta-1,3-dien-2-yl]pyrazol-1-yl]-2-pyridinyl]piperidin-4-one |
|---|---|
| PubChem CID | 178156897 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | ethane;1-[3-fluoro-5-[4-methyl-3-[(3Z)-penta-1,3-dien-2-yl]pyrazol-1-yl]-2-pyridinyl]piperidin-4-one |
| SMILES | C=C(/C=C\C)c1nn(-c2cnc(N3CCC(=O)CC3)c(F)c2)cc1C.CC |
| InChI | InChI=1S/C19H21FN4O.C2H6/c1-4-5-13(2)18-14(3)12-24(22-18)15-10-17(20)19(21-11-15)23-8-6-16(25)7-9-23;1-2/h4-5,10-12H,2,6-9H2,1,3H3;1-2H3/b5-4-; |
| InChIKey | RYGFGWUMMDRORL-MKWAYWHRSA-N |
| XLogP | 4.50 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|