About 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide
4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide (PubChem CID 174275878) has the molecular formula C12H18FN2O2P
and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide.
Molecular Properties
| Compound Name | 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide |
| PubChem CID | 174275878 |
| Molecular Formula | C12H18FN2O2P |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide |
| SMILES | CCOP1(=O)CCN(c2ncc(C)cc2F)CC1 |
| InChI | InChI=1S/C12H18FN2O2P/c1-3-17-18(16)6-4-15(5-7-18)12-11(13)8-10(2)9-14-12/h8-9H,3-7H2,1-2H3 |
| InChIKey | NZLWUPTVNKVLLL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide?
The IUPAC name of 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide (CID 174275878) is 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide.
What is the SMILES notation for 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide?
The canonical SMILES for 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide is CCOP1(=O)CCN(c2ncc(C)cc2F)CC1.
What is the InChIKey of 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide?
The InChIKey is NZLWUPTVNKVLLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FN2O2P/c1-3-17-18(16)6-4-15(5-7-18)12-11(13)8-10(2)9-14-12/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide?
4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide has a molecular weight of 272.26 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-1-(3-fluoro-5-methyl-2-pyridinyl)-1,4λ5-azaphosphinane 4-oxide is sourced from PubChem (CID 174275878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).