C15H15N3 — CID 123465502
(1R,5S)-1-phenyl-3-pyrimidin-2-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 123465502) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is (1R,5S)-1-phenyl-3-pyrimidin-2-yl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-1-phenyl-3-pyrimidin-2-yl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 123465502 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (1R,5S)-1-phenyl-3-pyrimidin-2-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | c1ccc([C@@]23C[C@@H]2CN(c2ncccn2)C3)cc1 |
| InChI | InChI=1S/C15H15N3/c1-2-5-12(6-3-1)15-9-13(15)10-18(11-15)14-16-7-4-8-17-14/h1-8,13H,9-11H2/t13-,15+/m1/s1 |
| InChIKey | VLHCSCODGBLPNQ-HIFRSBDPSA-N |
| XLogP | 2.25 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |