C25H28N4 — CID 154720556
2-[4-(3-methyl-1,3-diphenylcyclobutyl)piperazin-1-yl]pyrimidine (PubChem CID 154720556) has the molecular formula C25H28N4 and a molecular weight of 384.53 g/mol. Its IUPAC name is 2-[4-(3-methyl-1,3-diphenylcyclobutyl)piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-(3-methyl-1,3-diphenylcyclobutyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 154720556 |
| Molecular Formula | C25H28N4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-[4-(3-methyl-1,3-diphenylcyclobutyl)piperazin-1-yl]pyrimidine |
| SMILES | CC1(c2ccccc2)CC(c2ccccc2)(N2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C25H28N4/c1-24(21-9-4-2-5-10-21)19-25(20-24,22-11-6-3-7-12-22)29-17-15-28(16-18-29)23-26-13-8-14-27-23/h2-14H,15-20H2,1H3 |
| InChIKey | YPZSMZHKDBSIMK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |