C17H14F3N4O- — CID 143892098
2-[(1R,5S)-1-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboximidate (PubChem CID 143892098) has the molecular formula C17H14F3N4O- and a molecular weight of 347.32 g/mol. Its IUPAC name is 2-[(1R,5S)-1-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboximidate.
| Compound Name | 2-[(1R,5S)-1-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboximidate |
|---|---|
| PubChem CID | 143892098 |
| Molecular Formula | C17H14F3N4O- |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[(1R,5S)-1-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboximidate |
| SMILES | [H]/N=C(\[O-])c1cnc(N2C[C@H]3C[C@@]3(c3cccc(C(F)(F)F)c3)C2)nc1 |
| InChI | InChI=1S/C17H15F3N4O/c18-17(19,20)12-3-1-2-11(4-12)16-5-13(16)8-24(9-16)15-22-6-10(7-23-15)14(21)25/h1-4,6-7,13H,5,8-9H2,(H2,21,25)/p-1/t13-,16+/m1/s1 |
| InChIKey | YMKBAKNDBIKMDQ-CJNGLKHVSA-M |
| XLogP | 1.96 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|