C17H18F3NO — CID 167799782
1-bicyclo[1.1.0]butanyl-[3-methyl-3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 167799782) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is 1-bicyclo[1.1.0]butanyl-[3-methyl-3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | 1-bicyclo[1.1.0]butanyl-[3-methyl-3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 167799782 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-bicyclo[1.1.0]butanyl-[3-methyl-3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | CC1(c2cccc(C(F)(F)F)c2)CCN(C(=O)C23CC2C3)C1 |
| InChI | InChI=1S/C17H18F3NO/c1-15(11-3-2-4-12(7-11)17(18,19)20)5-6-21(10-15)14(22)16-8-13(16)9-16/h2-4,7,13H,5-6,8-10H2,1H3 |
| InChIKey | LYRFADRQSVMCNJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |