C19H24N2O — CID 124813445
(3aR,7aS)-6-(furan-2-ylmethyl)-1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine (PubChem CID 124813445) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (3aR,7aS)-6-(furan-2-ylmethyl)-1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine.
| Compound Name | (3aR,7aS)-6-(furan-2-ylmethyl)-1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 124813445 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (3aR,7aS)-6-(furan-2-ylmethyl)-1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine |
| SMILES | CN1CC[C@@]2(c3ccccc3)CCN(Cc3ccco3)C[C@@H]12 |
| InChI | InChI=1S/C19H24N2O/c1-20-11-9-19(16-6-3-2-4-7-16)10-12-21(15-18(19)20)14-17-8-5-13-22-17/h2-8,13,18H,9-12,14-15H2,1H3/t18-,19+/m1/s1 |
| InChIKey | ACSZNQVPNYRNTG-MOPGFXCFSA-N |
| XLogP | 3.13 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |