C19H22N2O2 — CID 97381103
[(3aR,7aR)-1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl]-(furan-3-yl)methanone (PubChem CID 97381103) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [(3aR,7aR)-1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl]-(furan-3-yl)methanone.
| Compound Name | [(3aR,7aR)-1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 97381103 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [(3aR,7aR)-1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl]-(furan-3-yl)methanone |
| SMILES | CN1CC[C@]2(c3ccccc3)CCN(C(=O)c3ccoc3)C[C@H]12 |
| InChI | InChI=1S/C19H22N2O2/c1-20-10-8-19(16-5-3-2-4-6-16)9-11-21(13-17(19)20)18(22)15-7-12-23-14-15/h2-7,12,14,17H,8-11,13H2,1H3/t17-,19+/m0/s1 |
| InChIKey | IDOZTHVDEJBFEB-PKOBYXMFSA-N |
| XLogP | 2.77 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |