C24H25F6N3O5 — CID 155833317
(1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl)-pyridin-4-ylmethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155833317) has the molecular formula C24H25F6N3O5 and a molecular weight of 549.47 g/mol. Its IUPAC name is (1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl)-pyridin-4-ylmethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl)-pyridin-4-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155833317 |
| Molecular Formula | C24H25F6N3O5 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl)-pyridin-4-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCC2(c3ccccc3)CCN(C(=O)c3ccncc3)CC12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23N3O.2C2HF3O2/c1-22-13-9-20(17-5-3-2-4-6-17)10-14-23(15-18(20)22)19(24)16-7-11-21-12-8-16;2*3-2(4,5)1(6)7/h2-8,11-12,18H,9-10,13-15H2,1H3;2*(H,6,7) |
| InChIKey | SVPHEVBCDQGZGZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |