C20H24F6N2O6 — CID 155853363
2-(1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl)acetic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155853363) has the molecular formula C20H24F6N2O6 and a molecular weight of 502.41 g/mol. Its IUPAC name is 2-(1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl)acetic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl)acetic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155853363 |
| Molecular Formula | C20H24F6N2O6 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-(1-methyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-6-yl)acetic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCC2(c3ccccc3)CCN(CC(=O)O)CC12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N2O2.2C2HF3O2/c1-17-9-7-16(13-5-3-2-4-6-13)8-10-18(11-14(16)17)12-15(19)20;2*3-2(4,5)1(6)7/h2-6,14H,7-12H2,1H3,(H,19,20);2*(H,6,7) |
| InChIKey | BWBAABRMIGOTFY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |