C17H18N2O3S — CID 131640761
[8-(pyridin-3-yloxymethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-thiophen-3-ylmethanone (PubChem CID 131640761) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is [8-(pyridin-3-yloxymethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-thiophen-3-ylmethanone.
| Compound Name | [8-(pyridin-3-yloxymethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 131640761 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [8-(pyridin-3-yloxymethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CC2(C1)OCCC2COc1cccnc1 |
| InChI | InChI=1S/C17H18N2O3S/c20-16(13-4-7-23-10-13)19-11-17(12-19)14(3-6-22-17)9-21-15-2-1-5-18-8-15/h1-2,4-5,7-8,10,14H,3,6,9,11-12H2 |
| InChIKey | QHEJQKBLCRRCNL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |