C17H18N4O3 — CID 133143433
[8-(pyridin-3-yloxymethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-pyrimidin-2-ylmethanone (PubChem CID 133143433) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is [8-(pyridin-3-yloxymethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-pyrimidin-2-ylmethanone.
| Compound Name | [8-(pyridin-3-yloxymethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 133143433 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [8-(pyridin-3-yloxymethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-pyrimidin-2-ylmethanone |
| SMILES | O=C(c1ncccn1)N1CC2(C1)OCCC2COc1cccnc1 |
| InChI | InChI=1S/C17H18N4O3/c22-16(15-19-6-2-7-20-15)21-11-17(12-21)13(4-8-24-17)10-23-14-3-1-5-18-9-14/h1-3,5-7,9,13H,4,8,10-12H2 |
| InChIKey | RTWURXFYVCUXGX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |