C14H22N4O3S — CID 131641336
N-(6-methylpyridazin-3-yl)-9-methylsulfonyl-1-oxa-9-azaspiro[4.5]decan-3-amine (PubChem CID 131641336) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(6-methylpyridazin-3-yl)-9-methylsulfonyl-1-oxa-9-azaspiro[4.5]decan-3-amine.
| Compound Name | N-(6-methylpyridazin-3-yl)-9-methylsulfonyl-1-oxa-9-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 131641336 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(6-methylpyridazin-3-yl)-9-methylsulfonyl-1-oxa-9-azaspiro[4.5]decan-3-amine |
| SMILES | Cc1ccc(NC2COC3(CCCN(S(C)(=O)=O)C3)C2)nn1 |
| InChI | InChI=1S/C14H22N4O3S/c1-11-4-5-13(17-16-11)15-12-8-14(21-9-12)6-3-7-18(10-14)22(2,19)20/h4-5,12H,3,6-10H2,1-2H3,(H,15,17) |
| InChIKey | XUOBBKIMJHRNBW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |