C20H28N4O2 — CID 131644254
8-(4-methoxyphenyl)-4-[(1-methylimidazol-2-yl)methyl]-1-oxa-4,8-diazaspiro[5.5]undecane (PubChem CID 131644254) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-4-[(1-methylimidazol-2-yl)methyl]-1-oxa-4,8-diazaspiro[5.5]undecane.
| Compound Name | 8-(4-methoxyphenyl)-4-[(1-methylimidazol-2-yl)methyl]-1-oxa-4,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 131644254 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 8-(4-methoxyphenyl)-4-[(1-methylimidazol-2-yl)methyl]-1-oxa-4,8-diazaspiro[5.5]undecane |
| SMILES | COc1ccc(N2CCCC3(CN(Cc4nccn4C)CCO3)C2)cc1 |
| InChI | InChI=1S/C20H28N4O2/c1-22-11-9-21-19(22)14-23-12-13-26-20(15-23)8-3-10-24(16-20)17-4-6-18(25-2)7-5-17/h4-7,9,11H,3,8,10,12-16H2,1-2H3 |
| InChIKey | INEVCOHZFFTEDT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|