C18H28N4O3 — CID 131644550
2-cyclopentyloxy-1-[3-[4-(propan-2-ylamino)pyrimidin-2-yl]morpholin-4-yl]ethanone (PubChem CID 131644550) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-cyclopentyloxy-1-[3-[4-(propan-2-ylamino)pyrimidin-2-yl]morpholin-4-yl]ethanone.
| Compound Name | 2-cyclopentyloxy-1-[3-[4-(propan-2-ylamino)pyrimidin-2-yl]morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 131644550 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2-cyclopentyloxy-1-[3-[4-(propan-2-ylamino)pyrimidin-2-yl]morpholin-4-yl]ethanone |
| SMILES | CC(C)Nc1ccnc(C2COCCN2C(=O)COC2CCCC2)n1 |
| InChI | InChI=1S/C18H28N4O3/c1-13(2)20-16-7-8-19-18(21-16)15-11-24-10-9-22(15)17(23)12-25-14-5-3-4-6-14/h7-8,13-15H,3-6,9-12H2,1-2H3,(H,19,20,21) |
| InChIKey | XGUYJBGXNLDLRX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |