C16H20N6O2 — CID 97483141
[(3R)-3-[4-(propan-2-ylamino)pyrimidin-2-yl]morpholin-4-yl]-pyrazin-2-ylmethanone (PubChem CID 97483141) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is [(3R)-3-[4-(propan-2-ylamino)pyrimidin-2-yl]morpholin-4-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3R)-3-[4-(propan-2-ylamino)pyrimidin-2-yl]morpholin-4-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 97483141 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(3R)-3-[4-(propan-2-ylamino)pyrimidin-2-yl]morpholin-4-yl]-pyrazin-2-ylmethanone |
| SMILES | CC(C)Nc1ccnc([C@@H]2COCCN2C(=O)c2cnccn2)n1 |
| InChI | InChI=1S/C16H20N6O2/c1-11(2)20-14-3-4-19-15(21-14)13-10-24-8-7-22(13)16(23)12-9-17-5-6-18-12/h3-6,9,11,13H,7-8,10H2,1-2H3,(H,19,20,21)/t13-/m0/s1 |
| InChIKey | HQUIRRHIWOZOJR-ZDUSSCGKSA-N |
| XLogP | 1.30 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |