C16H22ClNO4S — CID 131644998
6-(2-chlorophenyl)sulfonyl-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 131644998) has the molecular formula C16H22ClNO4S and a molecular weight of 359.88 g/mol. Its IUPAC name is 6-(2-chlorophenyl)sulfonyl-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | 6-(2-chlorophenyl)sulfonyl-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 131644998 |
| Molecular Formula | C16H22ClNO4S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 6-(2-chlorophenyl)sulfonyl-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | COCC12CCCOC1CCN(S(=O)(=O)c1ccccc1Cl)C2 |
| InChI | InChI=1S/C16H22ClNO4S/c1-21-12-16-8-4-10-22-15(16)7-9-18(11-16)23(19,20)14-6-3-2-5-13(14)17/h2-3,5-6,15H,4,7-12H2,1H3 |
| InChIKey | NMULZNBOMVHQDI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |