C16H22N4O2 — CID 131645592
6-ethyl-8-oxo-N-phenyl-2,6,9-triazaspiro[4.5]decane-2-carboxamide (PubChem CID 131645592) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 6-ethyl-8-oxo-N-phenyl-2,6,9-triazaspiro[4.5]decane-2-carboxamide.
| Compound Name | 6-ethyl-8-oxo-N-phenyl-2,6,9-triazaspiro[4.5]decane-2-carboxamide |
|---|---|
| PubChem CID | 131645592 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 6-ethyl-8-oxo-N-phenyl-2,6,9-triazaspiro[4.5]decane-2-carboxamide |
| SMILES | CCN1CC(=O)NCC12CCN(C(=O)Nc1ccccc1)C2 |
| InChI | InChI=1S/C16H22N4O2/c1-2-20-10-14(21)17-11-16(20)8-9-19(12-16)15(22)18-13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | HWUMIXAXKPOTMH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |