C19H29N3O — CID 134070803
1-pentyl-N-phenyl-1,7-diazaspiro[4.4]nonane-7-carboxamide (PubChem CID 134070803) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-pentyl-N-phenyl-1,7-diazaspiro[4.4]nonane-7-carboxamide.
| Compound Name | 1-pentyl-N-phenyl-1,7-diazaspiro[4.4]nonane-7-carboxamide |
|---|---|
| PubChem CID | 134070803 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 1-pentyl-N-phenyl-1,7-diazaspiro[4.4]nonane-7-carboxamide |
| SMILES | CCCCCN1CCCC12CCN(C(=O)Nc1ccccc1)C2 |
| InChI | InChI=1S/C19H29N3O/c1-2-3-7-13-22-14-8-11-19(22)12-15-21(16-19)18(23)20-17-9-5-4-6-10-17/h4-6,9-10H,2-3,7-8,11-16H2,1H3,(H,20,23) |
| InChIKey | AXCFOZRBJODNQP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|