C18H29N3O — CID 110174858
4-heptan-2-yl-N-phenylpiperazine-1-carboxamide (PubChem CID 110174858) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-heptan-2-yl-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-heptan-2-yl-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110174858 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 4-heptan-2-yl-N-phenylpiperazine-1-carboxamide |
| SMILES | CCCCCC(C)N1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C18H29N3O/c1-3-4-6-9-16(2)20-12-14-21(15-13-20)18(22)19-17-10-7-5-8-11-17/h5,7-8,10-11,16H,3-4,6,9,12-15H2,1-2H3,(H,19,22) |
| InChIKey | MHTYZYCXGNWYPR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|