C24H38N4O2 — CID 95065266
4-[2-[[(3R)-3-(azepan-1-yl)butyl]amino]-2-oxoethyl]-N-phenylpiperidine-1-carboxamide (PubChem CID 95065266) has the molecular formula C24H38N4O2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-[2-[[(3R)-3-(azepan-1-yl)butyl]amino]-2-oxoethyl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[2-[[(3R)-3-(azepan-1-yl)butyl]amino]-2-oxoethyl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 95065266 |
| Molecular Formula | C24H38N4O2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 4-[2-[[(3R)-3-(azepan-1-yl)butyl]amino]-2-oxoethyl]-N-phenylpiperidine-1-carboxamide |
| SMILES | C[C@H](CCNC(=O)CC1CCN(C(=O)Nc2ccccc2)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C24H38N4O2/c1-20(27-15-7-2-3-8-16-27)11-14-25-23(29)19-21-12-17-28(18-13-21)24(30)26-22-9-5-4-6-10-22/h4-6,9-10,20-21H,2-3,7-8,11-19H2,1H3,(H,25,29)(H,26,30)/t20-/m1/s1 |
| InChIKey | BHKCMCPCQSTDGE-HXUWFJFHSA-N |
| XLogP | 4.09 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |