C27H37N5O2 — CID 52998801
4-[2-[2-(4-benzylpiperazin-1-yl)ethylamino]-2-oxoethyl]-N-phenylpiperidine-1-carboxamide (PubChem CID 52998801) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 4-[2-[2-(4-benzylpiperazin-1-yl)ethylamino]-2-oxoethyl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[2-[2-(4-benzylpiperazin-1-yl)ethylamino]-2-oxoethyl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 52998801 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 4-[2-[2-(4-benzylpiperazin-1-yl)ethylamino]-2-oxoethyl]-N-phenylpiperidine-1-carboxamide |
| SMILES | O=C(CC1CCN(C(=O)Nc2ccccc2)CC1)NCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H37N5O2/c33-26(21-23-11-14-32(15-12-23)27(34)29-25-9-5-2-6-10-25)28-13-16-30-17-19-31(20-18-30)22-24-7-3-1-4-8-24/h1-10,23H,11-22H2,(H,28,33)(H,29,34) |
| InChIKey | QGALQYGEWXYGAZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |