C22H34N4O2 — CID 52998822
N-(4-methylphenyl)-4-[2-oxo-2-(2-piperidin-1-ylethylamino)ethyl]piperidine-1-carboxamide (PubChem CID 52998822) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-[2-oxo-2-(2-piperidin-1-ylethylamino)ethyl]piperidine-1-carboxamide.
| Compound Name | N-(4-methylphenyl)-4-[2-oxo-2-(2-piperidin-1-ylethylamino)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 52998822 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | N-(4-methylphenyl)-4-[2-oxo-2-(2-piperidin-1-ylethylamino)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC(CC(=O)NCCN3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H34N4O2/c1-18-5-7-20(8-6-18)24-22(28)26-14-9-19(10-15-26)17-21(27)23-11-16-25-12-3-2-4-13-25/h5-8,19H,2-4,9-17H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | JNUZRVSMFVKVMS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |