About 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide
6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide (PubChem CID 134076388) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide.
Molecular Properties
| Compound Name | 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide |
| PubChem CID | 134076388 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide |
| SMILES | CCCCCN1CC2CN(C(=O)Nc3ccccc3)CC21 |
| InChI | InChI=1S/C17H25N3O/c1-2-3-7-10-19-11-14-12-20(13-16(14)19)17(21)18-15-8-5-4-6-9-15/h4-6,8-9,14,16H,2-3,7,10-13H2,1H3,(H,18,21) |
| InChIKey | FMGGNRQGQPWWQM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide?
The IUPAC name of 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide (CID 134076388) is 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide.
What is the SMILES notation for 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide?
The canonical SMILES for 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide is CCCCCN1CC2CN(C(=O)Nc3ccccc3)CC21.
What is the InChIKey of 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide?
The InChIKey is FMGGNRQGQPWWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O/c1-2-3-7-10-19-11-14-12-20(13-16(14)19)17(21)18-15-8-5-4-6-9-15/h4-6,8-9,14,16H,2-3,7,10-13H2,1H3,(H,18,21).
What are the key properties of 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide?
6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide has a molecular weight of 287.41 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentyl-N-phenyl-3,6-diazabicyclo[3.2.0]heptane-3-carboxamide is sourced from PubChem (CID 134076388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).