C16H24N2O2 — CID 131650842
(3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-4-(oxolan-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 131650842) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-4-(oxolan-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-4-(oxolan-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 131650842 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-4-(oxolan-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | Cc1ccc(CN2CC[C@@H]3[C@@H]2CCN3C2CCOC2)o1 |
| InChI | InChI=1S/C16H24N2O2/c1-12-2-3-14(20-12)10-17-7-4-16-15(17)5-8-18(16)13-6-9-19-11-13/h2-3,13,15-16H,4-11H2,1H3/t13?,15-,16+/m0/s1 |
| InChIKey | LKROGKHWLIOURS-PXWJKWRZSA-N |
| XLogP | 2.03 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |