C14H20N4O2 — CID 131651352
8-(6-methoxypyrimidin-4-yl)-1,8-diazaspiro[5.5]undecan-2-one (PubChem CID 131651352) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 8-(6-methoxypyrimidin-4-yl)-1,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | 8-(6-methoxypyrimidin-4-yl)-1,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 131651352 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 8-(6-methoxypyrimidin-4-yl)-1,8-diazaspiro[5.5]undecan-2-one |
| SMILES | COc1cc(N2CCCC3(CCCC(=O)N3)C2)ncn1 |
| InChI | InChI=1S/C14H20N4O2/c1-20-13-8-11(15-10-16-13)18-7-3-6-14(9-18)5-2-4-12(19)17-14/h8,10H,2-7,9H2,1H3,(H,17,19) |
| InChIKey | JHLJRPIIBPLOLJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |