C19H24FNO2 — CID 131651775
1-(5-fluoro-1-prop-2-enoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)propan-1-one (PubChem CID 131651775) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is 1-(5-fluoro-1-prop-2-enoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)propan-1-one.
| Compound Name | 1-(5-fluoro-1-prop-2-enoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)propan-1-one |
|---|---|
| PubChem CID | 131651775 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1-(5-fluoro-1-prop-2-enoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)propan-1-one |
| SMILES | C=CCOC1CC2(CCN(C(=O)CC)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C19H24FNO2/c1-3-11-23-17-13-19(16-12-14(20)5-6-15(16)17)7-9-21(10-8-19)18(22)4-2/h3,5-6,12,17H,1,4,7-11,13H2,2H3 |
| InChIKey | SQCDBWQFNFGYNH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|