C16H21FN2O2 — CID 68978855
(2R,4S)-4-amino-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidine-1-carboxylic acid (PubChem CID 68978855) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is (2R,4S)-4-amino-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidine-1-carboxylic acid.
| Compound Name | (2R,4S)-4-amino-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68978855 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2R,4S)-4-amino-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidine-1-carboxylic acid |
| SMILES | C=CC[C@]1(N)CCN(C(=O)O)[C@@H](c2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C16H21FN2O2/c1-3-6-16(18)7-8-19(15(20)21)14(10-16)13-5-4-12(17)9-11(13)2/h3-5,9,14H,1,6-8,10,18H2,2H3,(H,20,21)/t14-,16+/m1/s1 |
| InChIKey | KMVTVLSCOBPWPN-ZBFHGGJFSA-N |
| XLogP | 3.22 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|