C29H34F7N3O2 — CID 58169912
(2R,5S,7R)-N-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluoro-2-methylphenyl)-2-(hydroxymethyl)-N,2-dimethyl-1,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 58169912) has the molecular formula C29H34F7N3O2 and a molecular weight of 589.60 g/mol. Its IUPAC name is (2R,5S,7R)-N-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluoro-2-methylphenyl)-2-(hydroxymethyl)-N,2-dimethyl-1,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | (2R,5S,7R)-N-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluoro-2-methylphenyl)-2-(hydroxymethyl)-N,2-dimethyl-1,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 58169912 |
| Molecular Formula | C29H34F7N3O2 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | (2R,5S,7R)-N-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluoro-2-methylphenyl)-2-(hydroxymethyl)-N,2-dimethyl-1,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | Cc1cc(F)ccc1[C@H]1C[C@@]2(CCN1C(=O)N(C)[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)CC[C@](C)(CO)N2 |
| InChI | InChI=1S/C29H34F7N3O2/c1-17-11-22(30)5-6-23(17)24-15-27(8-7-26(3,16-40)37-27)9-10-39(24)25(41)38(4)18(2)19-12-20(28(31,32)33)14-21(13-19)29(34,35)36/h5-6,11-14,18,24,37,40H,7-10,15-16H2,1-4H3/t18-,24-,26-,27+/m1/s1 |
| InChIKey | DONSXCCWWJVXDM-YLMCOQJISA-N |
| XLogP | 6.99 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |