C28H28F7N3O7 — CID 87242945
2-[(2R,4R)-1-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-methylcarbamoyl]-2-(4-fluoro-2-methylphenyl)-4-nitropiperidin-4-yl]butanedioic acid (PubChem CID 87242945) has the molecular formula C28H28F7N3O7 and a molecular weight of 651.53 g/mol. Its IUPAC name is 2-[(2R,4R)-1-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-methylcarbamoyl]-2-(4-fluoro-2-methylphenyl)-4-nitropiperidin-4-yl]butanedioic acid.
| Compound Name | 2-[(2R,4R)-1-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-methylcarbamoyl]-2-(4-fluoro-2-methylphenyl)-4-nitropiperidin-4-yl]butanedioic acid |
|---|---|
| PubChem CID | 87242945 |
| Molecular Formula | C28H28F7N3O7 |
| Molecular Weight | 651.53 g/mol |
| Exact Mass | 651.18 |
| IUPAC Name | 2-[(2R,4R)-1-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-methylcarbamoyl]-2-(4-fluoro-2-methylphenyl)-4-nitropiperidin-4-yl]butanedioic acid |
| SMILES | Cc1cc(F)ccc1[C@H]1C[C@](C(CC(=O)O)C(=O)O)([N+](=O)[O-])CCN1C(=O)N(C)[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H28F7N3O7/c1-14-8-19(29)4-5-20(14)22-13-26(38(44)45,21(24(41)42)12-23(39)40)6-7-37(22)25(43)36(3)15(2)16-9-17(27(30,31)32)11-18(10-16)28(33,34)35/h4-5,8-11,15,21-22H,6-7,12-13H2,1-3H3,(H,39,40)(H,41,42)/t15-,21?,22-,26-/m1/s1 |
| InChIKey | WKUHJDGGMIANOV-RPESHXANSA-N |
| XLogP | 6.31 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|